C24H20ClN5O2 — CID 160742066
1-(aminomethyl)-7-[5-(4-chloro-3-cyclopropyloxy-2-isocyanophenyl)-1-methylpyrazol-4-yl]-3H-isoquinolin-4-one (PubChem CID 160742066) has the molecular formula C24H20ClN5O2 and a molecular weight of 445.91 g/mol. Its IUPAC name is 1-(aminomethyl)-7-[5-(4-chloro-3-cyclopropyloxy-2-isocyanophenyl)-1-methylpyrazol-4-yl]-3H-isoquinolin-4-one.
| Compound Name | 1-(aminomethyl)-7-[5-(4-chloro-3-cyclopropyloxy-2-isocyanophenyl)-1-methylpyrazol-4-yl]-3H-isoquinolin-4-one |
|---|---|
| PubChem CID | 160742066 |
| Molecular Formula | C24H20ClN5O2 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-(aminomethyl)-7-[5-(4-chloro-3-cyclopropyloxy-2-isocyanophenyl)-1-methylpyrazol-4-yl]-3H-isoquinolin-4-one |
| SMILES | [C-]#[N+]c1c(-c2c(-c3ccc4c(c3)C(CN)=NCC4=O)cnn2C)ccc(Cl)c1OC1CC1 |
| InChI | InChI=1S/C24H20ClN5O2/c1-27-22-16(7-8-19(25)24(22)32-14-4-5-14)23-18(11-29-30(23)2)13-3-6-15-17(9-13)20(10-26)28-12-21(15)31/h3,6-9,11,14H,4-5,10,12,26H2,2H3 |
| InChIKey | MRVIQUWVCSOZQB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|