C24H16N4OS — CID 161021173
1-(aminomethyl)-7-[5-(1-isocyanonaphthalen-2-yl)-1,2-thiazol-4-yl]-3H-isoquinolin-4-one (PubChem CID 161021173) has the molecular formula C24H16N4OS and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-(aminomethyl)-7-[5-(1-isocyanonaphthalen-2-yl)-1,2-thiazol-4-yl]-3H-isoquinolin-4-one.
| Compound Name | 1-(aminomethyl)-7-[5-(1-isocyanonaphthalen-2-yl)-1,2-thiazol-4-yl]-3H-isoquinolin-4-one |
|---|---|
| PubChem CID | 161021173 |
| Molecular Formula | C24H16N4OS |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-(aminomethyl)-7-[5-(1-isocyanonaphthalen-2-yl)-1,2-thiazol-4-yl]-3H-isoquinolin-4-one |
| SMILES | [C-]#[N+]c1c(-c2sncc2-c2ccc3c(c2)C(CN)=NCC3=O)ccc2ccccc12 |
| InChI | InChI=1S/C24H16N4OS/c1-26-23-16-5-3-2-4-14(16)6-9-18(23)24-20(12-28-30-24)15-7-8-17-19(10-15)21(11-25)27-13-22(17)29/h2-10,12H,11,13,25H2 |
| InChIKey | ZKOXTTIFRMISAK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|