C24H17FN6O — CID 156656132
4-(aminomethyl)-6-[3-fluoro-5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one (PubChem CID 156656132) has the molecular formula C24H17FN6O and a molecular weight of 424.44 g/mol. Its IUPAC name is 4-(aminomethyl)-6-[3-fluoro-5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one.
| Compound Name | 4-(aminomethyl)-6-[3-fluoro-5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 156656132 |
| Molecular Formula | C24H17FN6O |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-(aminomethyl)-6-[3-fluoro-5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
| SMILES | [C-]#[N+]c1c(-c2c(-c3ccc4c(=O)[nH]nc(CN)c4c3)c(F)nn2C)ccc2ccccc12 |
| InChI | InChI=1S/C24H17FN6O/c1-27-21-15-6-4-3-5-13(15)7-10-17(21)22-20(23(25)30-31(22)2)14-8-9-16-18(11-14)19(12-26)28-29-24(16)32/h3-11H,12,26H2,2H3,(H,29,32) |
| InChIKey | BUGNWRCLISCJMG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|