C21H17ClN6O — CID 156655914
4-[(1S)-1-aminoethyl]-6-[5-(3-chloro-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one (PubChem CID 156655914) has the molecular formula C21H17ClN6O and a molecular weight of 404.86 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-6-[5-(3-chloro-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one.
| Compound Name | 4-[(1S)-1-aminoethyl]-6-[5-(3-chloro-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 156655914 |
| Molecular Formula | C21H17ClN6O |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-6-[5-(3-chloro-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
| SMILES | [C-]#[N+]c1c(Cl)cccc1-c1c(-c2ccc3c(=O)[nH]nc([C@H](C)N)c3c2)cnn1C |
| InChI | InChI=1S/C21H17ClN6O/c1-11(23)18-15-9-12(7-8-13(15)21(29)27-26-18)16-10-25-28(3)20(16)14-5-4-6-17(22)19(14)24-2/h4-11H,23H2,1,3H3,(H,27,29)/t11-/m0/s1 |
| InChIKey | YXAXROLMQWGIEI-NSHDSACASA-N |
| XLogP | 4.21 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|