C23H20N6O — CID 156655907
4-(aminomethyl)-6-[5-(3-cyclopropyl-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one (PubChem CID 156655907) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-(aminomethyl)-6-[5-(3-cyclopropyl-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one.
| Compound Name | 4-(aminomethyl)-6-[5-(3-cyclopropyl-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 156655907 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-(aminomethyl)-6-[5-(3-cyclopropyl-2-isocyanophenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
| SMILES | [C-]#[N+]c1c(-c2c(-c3ccc4c(=O)[nH]nc(CN)c4c3)cnn2C)cccc1C1CC1 |
| InChI | InChI=1S/C23H20N6O/c1-25-21-15(13-6-7-13)4-3-5-17(21)22-19(12-26-29(22)2)14-8-9-16-18(10-14)20(11-24)27-28-23(16)30/h3-5,8-10,12-13H,6-7,11,24H2,2H3,(H,28,30) |
| InChIKey | PWSWTAOIKHHBAD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|