C72H51Cl3N18O3 — CID 158200058
4-(aminomethyl)-6-[5-(1-chloro-3-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one (PubChem CID 158200058) has the molecular formula C72H51Cl3N18O3 and a molecular weight of 1322.68 g/mol. Its IUPAC name is 4-(aminomethyl)-6-[5-(1-chloro-3-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one.
| Compound Name | 4-(aminomethyl)-6-[5-(1-chloro-3-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 158200058 |
| Molecular Formula | C72H51Cl3N18O3 |
| Molecular Weight | 1322.68 g/mol |
| Exact Mass | 1320.35 |
| IUPAC Name | 4-(aminomethyl)-6-[5-(1-chloro-3-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
| SMILES | [C-]#[N+]c1cc2ccccc2c(Cl)c1-c1c(-c2ccc3c(=O)[nH]nc(CN)c3c2)cnn1C.[C-]#[N+]c1cc2ccccc2c(Cl)c1-c1c(-c2ccc3c(=O)[nH]nc(CN)c3c2)cnn1C.[C-]#[N+]c1cc2ccccc2c(Cl)c1-c1c(-c2ccc3c(=O)[nH]nc(CN)c3c2)cnn1C |
| InChI | InChI=1S/3C24H17ClN6O/c3*1-27-19-10-13-5-3-4-6-15(13)22(25)21(19)23-18(12-28-31(23)2)14-7-8-16-17(9-14)20(11-26)29-30-24(16)32/h3*3-10,12H,11,26H2,2H3,(H,30,32) |
| InChIKey | GAUZTWDLMQFKBX-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 281.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 96 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1322.68 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|