C25H19N5O — CID 167692245
4-ethyl-6-[5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one (PubChem CID 167692245) has the molecular formula C25H19N5O and a molecular weight of 405.46 g/mol. Its IUPAC name is 4-ethyl-6-[5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one.
| Compound Name | 4-ethyl-6-[5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 167692245 |
| Molecular Formula | C25H19N5O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-ethyl-6-[5-(1-isocyanonaphthalen-2-yl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
| SMILES | [C-]#[N+]c1c(-c2c(-c3ccc4c(=O)[nH]nc(CC)c4c3)cnn2C)ccc2ccccc12 |
| InChI | InChI=1S/C25H19N5O/c1-4-22-20-13-16(10-11-18(20)25(31)29-28-22)21-14-27-30(3)24(21)19-12-9-15-7-5-6-8-17(15)23(19)26-2/h5-14H,4H2,1,3H3,(H,29,31) |
| InChIKey | UFGNTKIGFGQQEV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|