C21H17ClN6O2 — CID 156656098
4-(aminomethyl)-6-[5-(4-chloro-2-isocyano-5-methoxyphenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one (PubChem CID 156656098) has the molecular formula C21H17ClN6O2 and a molecular weight of 420.86 g/mol. Its IUPAC name is 4-(aminomethyl)-6-[5-(4-chloro-2-isocyano-5-methoxyphenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one.
| Compound Name | 4-(aminomethyl)-6-[5-(4-chloro-2-isocyano-5-methoxyphenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 156656098 |
| Molecular Formula | C21H17ClN6O2 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-(aminomethyl)-6-[5-(4-chloro-2-isocyano-5-methoxyphenyl)-1-methylpyrazol-4-yl]-2H-phthalazin-1-one |
| SMILES | [C-]#[N+]c1cc(Cl)c(OC)cc1-c1c(-c2ccc3c(=O)[nH]nc(CN)c3c2)cnn1C |
| InChI | InChI=1S/C21H17ClN6O2/c1-24-17-8-16(22)19(30-3)7-14(17)20-15(10-25-28(20)2)11-4-5-12-13(6-11)18(9-23)26-27-21(12)29/h4-8,10H,9,23H2,2-3H3,(H,27,29) |
| InChIKey | JVGNWWQFVCXLAK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|