C39H48BBrN6O3Si — CID 160743492
[6-(6-bromoindazol-1-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane;1-(6-ethyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 160743492) has the molecular formula C39H48BBrN6O3Si and a molecular weight of 767.65 g/mol. Its IUPAC name is [6-(6-bromoindazol-1-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane;1-(6-ethyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | [6-(6-bromoindazol-1-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane;1-(6-ethyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 160743492 |
| Molecular Formula | C39H48BBrN6O3Si |
| Molecular Weight | 767.65 g/mol |
| Exact Mass | 766.28 |
| IUPAC Name | [6-(6-bromoindazol-1-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane;1-(6-ethyl-2-pyridinyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(-n2ncc3ccc(Br)cc32)n1.CCc1cccc(-n2ncc3ccc(B4OC(C)(C)C(C)(C)O4)cc32)n1 |
| InChI | InChI=1S/C20H24BN3O2.C19H24BrN3OSi/c1-6-16-8-7-9-18(23-16)24-17-12-15(11-10-14(17)13-22-24)21-25-19(2,3)20(4,5)26-21;1-19(2,3)25(4,5)24-13-16-7-6-8-18(22-16)23-17-11-15(20)10-9-14(17)12-21-23/h7-13H,6H2,1-5H3;6-12H,13H2,1-5H3 |
| InChIKey | RVWXVUOKAPQELZ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 89.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.65 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|