C19H24BrN3OSi — CID 140798469
[6-(6-bromoindazol-2-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 140798469) has the molecular formula C19H24BrN3OSi and a molecular weight of 418.41 g/mol. Its IUPAC name is [6-(6-bromoindazol-2-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [6-(6-bromoindazol-2-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140798469 |
| Molecular Formula | C19H24BrN3OSi |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [6-(6-bromoindazol-2-yl)-2-pyridinyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(-n2cc3ccc(Br)cc3n2)n1 |
| InChI | InChI=1S/C19H24BrN3OSi/c1-19(2,3)25(4,5)24-13-16-7-6-8-18(21-16)23-12-14-9-10-15(20)11-17(14)22-23/h6-12H,13H2,1-5H3 |
| InChIKey | JUNZFBOZSJUGST-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|