C30H32Br2N8O2Si — CID 161262421
[6-(6-bromoindazol-1-yl)pyrazin-2-yl]methanol;[6-(6-bromoindazol-1-yl)pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 161262421) has the molecular formula C30H32Br2N8O2Si and a molecular weight of 724.53 g/mol. Its IUPAC name is [6-(6-bromoindazol-1-yl)pyrazin-2-yl]methanol;[6-(6-bromoindazol-1-yl)pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [6-(6-bromoindazol-1-yl)pyrazin-2-yl]methanol;[6-(6-bromoindazol-1-yl)pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 161262421 |
| Molecular Formula | C30H32Br2N8O2Si |
| Molecular Weight | 724.53 g/mol |
| Exact Mass | 722.08 |
| IUPAC Name | [6-(6-bromoindazol-1-yl)pyrazin-2-yl]methanol;[6-(6-bromoindazol-1-yl)pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cncc(-n2ncc3ccc(Br)cc32)n1.OCc1cncc(-n2ncc3ccc(Br)cc32)n1 |
| InChI | InChI=1S/C18H23BrN4OSi.C12H9BrN4O/c1-18(2,3)25(4,5)24-12-15-10-20-11-17(22-15)23-16-8-14(19)7-6-13(16)9-21-23;13-9-2-1-8-4-15-17(11(8)3-9)12-6-14-5-10(7-18)16-12/h6-11H,12H2,1-5H3;1-6,18H,7H2 |
| InChIKey | VCSRCBADLJSNTG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.53 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|