C21H29BrN4O3Si — CID 140798244
[6-[6-bromo-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 140798244) has the molecular formula C21H29BrN4O3Si and a molecular weight of 493.48 g/mol. Its IUPAC name is [6-[6-bromo-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [6-[6-bromo-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140798244 |
| Molecular Formula | C21H29BrN4O3Si |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | [6-[6-bromo-4-(2-methoxyethoxy)indazol-1-yl]pyrazin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COCCOc1cc(Br)cc2c1cnn2-c1cncc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C21H29BrN4O3Si/c1-21(2,3)30(5,6)29-14-16-11-23-13-20(25-16)26-18-9-15(22)10-19(17(18)12-24-26)28-8-7-27-4/h9-13H,7-8,14H2,1-6H3 |
| InChIKey | ALXQWWVSBZGABW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|