C20H40N4O3 — CID 160746764
tert-butyl N-[N-[(4S)-4-amino-5-(octylamino)-5-oxopentyl]-C-methylcarbonimidoyl]carbamate (PubChem CID 160746764) has the molecular formula C20H40N4O3 and a molecular weight of 384.57 g/mol. Its IUPAC name is tert-butyl N-[N-[(4S)-4-amino-5-(octylamino)-5-oxopentyl]-C-methylcarbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(4S)-4-amino-5-(octylamino)-5-oxopentyl]-C-methylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 160746764 |
| Molecular Formula | C20H40N4O3 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | tert-butyl N-[N-[(4S)-4-amino-5-(octylamino)-5-oxopentyl]-C-methylcarbonimidoyl]carbamate |
| SMILES | CCCCCCCCNC(=O)[C@@H](N)CCC/N=C(\C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N4O3/c1-6-7-8-9-10-11-14-23-18(25)17(21)13-12-15-22-16(2)24-19(26)27-20(3,4)5/h17H,6-15,21H2,1-5H3,(H,23,25)(H,22,24,26)/t17-/m0/s1 |
| InChIKey | RWHCECSUWMHMBW-KRWDZBQOSA-N |
| XLogP | 3.51 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|