C34H56O3 — CID 160754576
(3R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,7,12-tris(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 160754576) has the molecular formula C34H56O3 and a molecular weight of 512.82 g/mol. Its IUPAC name is (3R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,7,12-tris(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,7,12-tris(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 160754576 |
| Molecular Formula | C34H56O3 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.42 |
| IUPAC Name | (3R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,7,12-tris(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=CCOC1CC2C[C@H](OCC=C)CC[C@]2(C)[C@H]2C[C@H](OCC=C)[C@]3(C)[C@@H]([C@H](C)CCCC)CC[C@H]3C12 |
| InChI | InChI=1S/C34H56O3/c1-8-12-13-24(5)27-14-15-28-32-29(23-31(34(27,28)7)37-20-11-4)33(6)17-16-26(35-18-9-2)21-25(33)22-30(32)36-19-10-3/h9-11,24-32H,2-4,8,12-23H2,1,5-7H3/t24-,25?,26-,27-,28+,29+,30?,31+,32?,33+,34-/m1/s1 |
| InChIKey | PKBOVXWBONDBGA-FWDBXMRHSA-N |
| XLogP | 8.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|