C31H52O3 — CID 58942801
(3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,12-bis(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol (PubChem CID 58942801) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,12-bis(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | (3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,12-bis(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 58942801 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-hexan-2-yl]-10,13-dimethyl-3,12-bis(prop-2-enoxy)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| SMILES | C=CCO[C@@H]1CC[C@@]2(C)[C@@H](C1)C[C@@H](O)[C@@H]1[C@@H]2C[C@H](OCC=C)[C@]2(C)[C@@H]([C@H](C)CCCC)CC[C@@H]12 |
| InChI | InChI=1S/C31H52O3/c1-7-10-11-21(4)24-12-13-25-29-26(20-28(31(24,25)6)34-17-9-3)30(5)15-14-23(33-16-8-2)18-22(30)19-27(29)32/h8-9,21-29,32H,2-3,7,10-20H2,1,4-6H3/t21-,22+,23-,24-,25+,26+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | XJJFTLFZKUDGJF-OZIGVYFBSA-N |
| XLogP | 7.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|