C28H48O — CID 118241377
(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-pentan-2-yl]-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 118241377) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-pentan-2-yl]-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-pentan-2-yl]-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 118241377 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | (3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-pentan-2-yl]-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=CCO[C@H]1C[C@H]2[C@@H](CC[C@@H]3C[C@H](C)CC[C@@]32C)[C@@H]2CC[C@H]([C@H](C)CCC)[C@@]12C |
| InChI | InChI=1S/C28H48O/c1-7-9-20(4)23-12-13-24-22-11-10-21-17-19(3)14-15-27(21,5)25(22)18-26(28(23,24)6)29-16-8-2/h8,19-26H,2,7,9-18H2,1,3-6H3/t19-,20-,21-,22+,23-,24+,25+,26+,27+,28-/m1/s1 |
| InChIKey | VWRYCHUTZICQRQ-WCQCBKTDSA-N |
| XLogP | 7.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|