C29H50O2 — CID 58225183
(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2S)-hexan-2-yl]-3,10,13-trimethyl-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol (PubChem CID 58225183) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is (3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2S)-hexan-2-yl]-3,10,13-trimethyl-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | (3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2S)-hexan-2-yl]-3,10,13-trimethyl-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 58225183 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | (3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2S)-hexan-2-yl]-3,10,13-trimethyl-12-prop-2-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| SMILES | C=CCO[C@H]1C[C@H]2[C@@H]([C@H](O)C[C@@H]3C[C@H](C)CC[C@@]32C)[C@@H]2CC[C@H]([C@@H](C)CCCC)[C@@]12C |
| InChI | InChI=1S/C29H50O2/c1-7-9-10-20(4)22-11-12-23-27-24(18-26(29(22,23)6)31-15-8-2)28(5)14-13-19(3)16-21(28)17-25(27)30/h8,19-27,30H,2,7,9-18H2,1,3-6H3/t19-,20+,21+,22-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | JABCHXUCMXXVOB-IFFDDLRHSA-N |
| XLogP | 7.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|