C23H29NO6P2+2 — CID 160768842
[3,5-diethyl-4-(4-phenylphenyl)phenyl]methanamine;bis(dihydroxy(oxo)phosphanium) (PubChem CID 160768842) has the molecular formula C23H29NO6P2+2 and a molecular weight of 477.43 g/mol. Its IUPAC name is [3,5-diethyl-4-(4-phenylphenyl)phenyl]methanamine;bis(dihydroxy(oxo)phosphanium).
| Compound Name | [3,5-diethyl-4-(4-phenylphenyl)phenyl]methanamine;bis(dihydroxy(oxo)phosphanium) |
|---|---|
| PubChem CID | 160768842 |
| Molecular Formula | C23H29NO6P2+2 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [3,5-diethyl-4-(4-phenylphenyl)phenyl]methanamine;bis(dihydroxy(oxo)phosphanium) |
| SMILES | CCc1cc(CN)cc(CC)c1-c1ccc(-c2ccccc2)cc1.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C23H25N.2HO3P/c1-3-18-14-17(16-24)15-19(4-2)23(18)22-12-10-21(11-13-22)20-8-6-5-7-9-20;2*1-4(2)3/h5-15H,3-4,16,24H2,1-2H3;2*(H-,1,2,3)/p+2 |
| InChIKey | BIIWXZRVTHKUPG-UHFFFAOYSA-P |
| XLogP | 4.86 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|