About 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol
2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol (PubChem CID 160772979) has the molecular formula C16H18BrClO2
and a molecular weight of 357.68 g/mol. Its IUPAC name is 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol.
Molecular Properties
| Compound Name | 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol |
| PubChem CID | 160772979 |
| Molecular Formula | C16H18BrClO2 |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol |
| SMILES | CC(C)c1cccc(Br)c1O.Cc1cccc(Cl)c1O |
| InChI | InChI=1S/C9H11BrO.C7H7ClO/c1-6(2)7-4-3-5-8(10)9(7)11;1-5-3-2-4-6(8)7(5)9/h3-6,11H,1-2H3;2-4,9H,1H3 |
| InChIKey | RZOHIQNJSGOKCL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol?
The IUPAC name of 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol (CID 160772979) is 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol.
What is the SMILES notation for 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol?
The canonical SMILES for 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol is CC(C)c1cccc(Br)c1O.Cc1cccc(Cl)c1O.
What is the InChIKey of 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol?
The InChIKey is RZOHIQNJSGOKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO.C7H7ClO/c1-6(2)7-4-3-5-8(10)9(7)11;1-5-3-2-4-6(8)7(5)9/h3-6,11H,1-2H3;2-4,9H,1H3.
What are the key properties of 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol?
2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol has a molecular weight of 357.68 g/mol, XLogP of 5.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-propan-2-ylphenol;2-chloro-6-methylphenol is sourced from PubChem (CID 160772979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).