C29H31NO5 — CID 160778155
(3S)-3-[[(2S)-5-naphthalen-1-yl-3-oxopentan-2-yl]carbamoyl]-5-oxo-7-phenylheptanoic acid (PubChem CID 160778155) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is (3S)-3-[[(2S)-5-naphthalen-1-yl-3-oxopentan-2-yl]carbamoyl]-5-oxo-7-phenylheptanoic acid.
| Compound Name | (3S)-3-[[(2S)-5-naphthalen-1-yl-3-oxopentan-2-yl]carbamoyl]-5-oxo-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 160778155 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (3S)-3-[[(2S)-5-naphthalen-1-yl-3-oxopentan-2-yl]carbamoyl]-5-oxo-7-phenylheptanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](CC(=O)O)CC(=O)CCc1ccccc1)C(=O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H31NO5/c1-20(27(32)17-15-23-12-7-11-22-10-5-6-13-26(22)23)30-29(35)24(19-28(33)34)18-25(31)16-14-21-8-3-2-4-9-21/h2-13,20,24H,14-19H2,1H3,(H,30,35)(H,33,34)/t20-,24-/m0/s1 |
| InChIKey | SAFMKMFITSMTAP-RDPSFJRHSA-N |
| XLogP | 4.53 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |