C27H28F6N4O5S2 — CID 160781028
methyl 2-amino-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate;methyl 2-isocyanato-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate (PubChem CID 160781028) has the molecular formula C27H28F6N4O5S2 and a molecular weight of 666.67 g/mol. Its IUPAC name is methyl 2-amino-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate;methyl 2-isocyanato-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-amino-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate;methyl 2-isocyanato-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 160781028 |
| Molecular Formula | C27H28F6N4O5S2 |
| Molecular Weight | 666.67 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | methyl 2-amino-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate;methyl 2-isocyanato-5-thiomorpholin-4-yl-4-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(N2CCSCC2)c(C(F)(F)F)cc1N.COC(=O)c1cc(N2CCSCC2)c(C(F)(F)F)cc1N=C=O |
| InChI | InChI=1S/C14H13F3N2O3S.C13H15F3N2O2S/c1-22-13(21)9-6-12(19-2-4-23-5-3-19)10(14(15,16)17)7-11(9)18-8-20;1-20-12(19)8-6-11(18-2-4-21-5-3-18)9(7-10(8)17)13(14,15)16/h6-7H,2-5H2,1H3;6-7H,2-5,17H2,1H3 |
| InChIKey | SAOOZJABFFHVTR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|