C20H20F3N3O4 — CID 160783529
(5R)-5-ethyl-3-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-3-yl]-1,3-oxazolidin-2-one (PubChem CID 160783529) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is (5R)-5-ethyl-3-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-3-yl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-ethyl-3-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-3-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 160783529 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (5R)-5-ethyl-3-[(6S)-6-methyl-5-[2-(3,4,5-trifluorophenyl)acetyl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-3-yl]-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H]1CN(c2onc3c2CN(C(=O)Cc2cc(F)c(F)c(F)c2)[C@@H](C)C3)C(=O)O1 |
| InChI | InChI=1S/C20H20F3N3O4/c1-3-12-8-26(20(28)29-12)19-13-9-25(10(2)4-16(13)24-30-19)17(27)7-11-5-14(21)18(23)15(22)6-11/h5-6,10,12H,3-4,7-9H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | SAXAPZJAKRQTEO-CMPLNLGQSA-N |
| XLogP | 3.34 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|