C27H28N6O2S2 — CID 160794250
7-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)methyl]cyclopentyl]methyl]-1,3-benzothiazole-6-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 160794250) has the molecular formula C27H28N6O2S2 and a molecular weight of 532.70 g/mol. Its IUPAC name is 7-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)methyl]cyclopentyl]methyl]-1,3-benzothiazole-6-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)methyl]cyclopentyl]methyl]-1,3-benzothiazole-6-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 160794250 |
| Molecular Formula | C27H28N6O2S2 |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 7-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)methyl]cyclopentyl]methyl]-1,3-benzothiazole-6-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CSc1cnc(C[C@H]2CC[C@H](Cc3nc4ccc(C(=O)N5CCc6c(nc[nH]c6=O)C5)cc4s3)C2)nc1 |
| InChI | InChI=1S/C27H28N6O2S2/c1-36-19-12-28-24(29-13-19)9-16-2-3-17(8-16)10-25-32-21-5-4-18(11-23(21)37-25)27(35)33-7-6-20-22(14-33)30-15-31-26(20)34/h4-5,11-13,15-17H,2-3,6-10,14H2,1H3,(H,30,31,34)/t16-,17-/m0/s1 |
| InChIKey | SCFNXMKQUNXHCO-IRXDYDNUSA-N |
| XLogP | 4.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |