C51H54F3N5O6 — CID 160812112
tert-butyl N-[2-[[4-[(8-oxo-9-trityloxynonanoyl)amino]benzoyl]-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]amino]ethyl]carbamate (PubChem CID 160812112) has the molecular formula C51H54F3N5O6 and a molecular weight of 890.02 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[(8-oxo-9-trityloxynonanoyl)amino]benzoyl]-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[(8-oxo-9-trityloxynonanoyl)amino]benzoyl]-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 160812112 |
| Molecular Formula | C51H54F3N5O6 |
| Molecular Weight | 890.02 g/mol |
| Exact Mass | 889.40 |
| IUPAC Name | tert-butyl N-[2-[[4-[(8-oxo-9-trityloxynonanoyl)amino]benzoyl]-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(Cc1ccc(C2(C(F)(F)F)N=N2)cc1)C(=O)c1ccc(NC(=O)CCCCCCC(=O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C51H54F3N5O6/c1-48(2,3)65-47(63)55-33-34-59(35-37-25-29-42(30-26-37)50(57-58-50)51(52,53)54)46(62)38-27-31-43(32-28-38)56-45(61)24-16-5-4-15-23-44(60)36-64-49(39-17-9-6-10-18-39,40-19-11-7-12-20-40)41-21-13-8-14-22-41/h6-14,17-22,25-32H,4-5,15-16,23-24,33-36H2,1-3H3,(H,55,63)(H,56,61) |
| InChIKey | PZACWNGFWQWTNV-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.02 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|