C36H45F3N4O4 — CID 70890632
tert-butyl N-[2-[benzyl-[5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-[3-(trifluoromethyl)anilino]butan-2-yl]amino]pentyl]amino]ethyl]carbamate (PubChem CID 70890632) has the molecular formula C36H45F3N4O4 and a molecular weight of 654.77 g/mol. Its IUPAC name is tert-butyl N-[2-[benzyl-[5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-[3-(trifluoromethyl)anilino]butan-2-yl]amino]pentyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[benzyl-[5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-[3-(trifluoromethyl)anilino]butan-2-yl]amino]pentyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 70890632 |
| Molecular Formula | C36H45F3N4O4 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | tert-butyl N-[2-[benzyl-[5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-[3-(trifluoromethyl)anilino]butan-2-yl]amino]pentyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(CCCCC(=O)N[C@H](CCc1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1)Cc1ccccc1 |
| InChI | InChI=1S/C36H45F3N4O4/c1-35(2,3)47-34(46)40-22-24-43(26-28-15-8-5-9-16-28)23-11-10-19-32(44)42-31(21-20-27-13-6-4-7-14-27)33(45)41-30-18-12-17-29(25-30)36(37,38)39/h4-9,12-18,25,31H,10-11,19-24,26H2,1-3H3,(H,40,46)(H,41,45)(H,42,44)/t31-/m1/s1 |
| InChIKey | KXSJTCAVRTWQJS-WJOKGBTCSA-N |
| XLogP | 6.96 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|