C28H37N5O6 — CID 160818875
(2S)-2-[[(2R,5S)-2-(4-aminobutyl)-5-[(3-methoxybenzoyl)amino]-4-oxo-6-phenylhexanoyl]amino]butanediamide (PubChem CID 160818875) has the molecular formula C28H37N5O6 and a molecular weight of 539.63 g/mol. Its IUPAC name is (2S)-2-[[(2R,5S)-2-(4-aminobutyl)-5-[(3-methoxybenzoyl)amino]-4-oxo-6-phenylhexanoyl]amino]butanediamide.
| Compound Name | (2S)-2-[[(2R,5S)-2-(4-aminobutyl)-5-[(3-methoxybenzoyl)amino]-4-oxo-6-phenylhexanoyl]amino]butanediamide |
|---|---|
| PubChem CID | 160818875 |
| Molecular Formula | C28H37N5O6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | (2S)-2-[[(2R,5S)-2-(4-aminobutyl)-5-[(3-methoxybenzoyl)amino]-4-oxo-6-phenylhexanoyl]amino]butanediamide |
| SMILES | COc1cccc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(N)=O)c1 |
| InChI | InChI=1S/C28H37N5O6/c1-39-21-12-7-11-19(15-21)27(37)32-22(14-18-8-3-2-4-9-18)24(34)16-20(10-5-6-13-29)28(38)33-23(26(31)36)17-25(30)35/h2-4,7-9,11-12,15,20,22-23H,5-6,10,13-14,16-17,29H2,1H3,(H2,30,35)(H2,31,36)(H,32,37)(H,33,38)/t20-,22+,23+/m1/s1 |
| InChIKey | HFKUMRNAODUVCR-PUHATCMVSA-N |
| XLogP | 0.59 |
| TPSA | 196.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|