C16H22O4 — CID 160822746
(3R,4S,5S)-7-deuterio-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-7-en-6-one (PubChem CID 160822746) has the molecular formula C16H22O4 and a molecular weight of 279.35 g/mol. Its IUPAC name is (3R,4S,5S)-7-deuterio-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-7-en-6-one.
| Compound Name | (3R,4S,5S)-7-deuterio-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-7-en-6-one |
|---|---|
| PubChem CID | 160822746 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (3R,4S,5S)-7-deuterio-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-7-en-6-one |
| SMILES | [2H]C1=C[C@]2(CO2)[C@@H]([C@]2(C)O[C@@H]2CC=C(C)C)[C@H](OC)C1=O |
| InChI | InChI=1S/C16H22O4/c1-10(2)5-6-12-15(3,20-12)14-13(18-4)11(17)7-8-16(14)9-19-16/h5,7-8,12-14H,6,9H2,1-4H3/t12-,13-,14-,15-,16+/m1/s1/i7D |
| InChIKey | SFTKRJHCMQJZSJ-RLUWAOGRSA-N |
| XLogP | 2.04 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|