C17H21F3O4 — CID 123418814
7-methoxy-4-methyl-8-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one (PubChem CID 123418814) has the molecular formula C17H21F3O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is 7-methoxy-4-methyl-8-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one.
| Compound Name | 7-methoxy-4-methyl-8-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one |
|---|---|
| PubChem CID | 123418814 |
| Molecular Formula | C17H21F3O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 7-methoxy-4-methyl-8-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one |
| SMILES | COC1C(=O)C=C(C)C2(CO2)C1C1(C)OC1CC=C(C)C(F)(F)F |
| InChI | InChI=1S/C17H21F3O4/c1-9(17(18,19)20)5-6-12-15(3,24-12)14-13(22-4)11(21)7-10(2)16(14)8-23-16/h5,7,12-14H,6,8H2,1-4H3 |
| InChIKey | XNJQBDIMJOALEN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|