C17H26O4 — CID 123405007
7-methoxy-4-methyl-8-[2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one (PubChem CID 123405007) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 7-methoxy-4-methyl-8-[2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one.
| Compound Name | 7-methoxy-4-methyl-8-[2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one |
|---|---|
| PubChem CID | 123405007 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 7-methoxy-4-methyl-8-[2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-4-en-6-one |
| SMILES | COC1C(=O)C=C(C)C2(CO2)C1C1(C)OC1CCC(C)C |
| InChI | InChI=1S/C17H26O4/c1-10(2)6-7-13-16(4,21-13)15-14(19-5)12(18)8-11(3)17(15)9-20-17/h8,10,13-15H,6-7,9H2,1-5H3 |
| InChIKey | COQAUEWOUNJNLO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|