C17H23F3O5 — CID 123432904
5,7-dimethoxy-4-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one (PubChem CID 123432904) has the molecular formula C17H23F3O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 5,7-dimethoxy-4-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one.
| Compound Name | 5,7-dimethoxy-4-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one |
|---|---|
| PubChem CID | 123432904 |
| Molecular Formula | C17H23F3O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5,7-dimethoxy-4-[2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-one |
| SMILES | COC1CC2(CO2)C(C2(C)OC2CC=C(C)C(F)(F)F)C(OC)C1=O |
| InChI | InChI=1S/C17H23F3O5/c1-9(17(18,19)20)5-6-11-15(2,25-11)14-13(23-4)12(21)10(22-3)7-16(14)8-24-16/h5,10-11,13-14H,6-8H2,1-4H3 |
| InChIKey | CJBODPHERVSTGN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|