C16H21FO4 — CID 88930924
(3R,4S,5S,7S)-4-[(2R,3R)-3-(2-cyclopropylideneethyl)-2-methyloxiran-2-yl]-7-fluoro-5-methoxy-1-oxaspiro[2.5]octan-6-one (PubChem CID 88930924) has the molecular formula C16H21FO4 and a molecular weight of 296.34 g/mol. Its IUPAC name is (3R,4S,5S,7S)-4-[(2R,3R)-3-(2-cyclopropylideneethyl)-2-methyloxiran-2-yl]-7-fluoro-5-methoxy-1-oxaspiro[2.5]octan-6-one.
| Compound Name | (3R,4S,5S,7S)-4-[(2R,3R)-3-(2-cyclopropylideneethyl)-2-methyloxiran-2-yl]-7-fluoro-5-methoxy-1-oxaspiro[2.5]octan-6-one |
|---|---|
| PubChem CID | 88930924 |
| Molecular Formula | C16H21FO4 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3R,4S,5S,7S)-4-[(2R,3R)-3-(2-cyclopropylideneethyl)-2-methyloxiran-2-yl]-7-fluoro-5-methoxy-1-oxaspiro[2.5]octan-6-one |
| SMILES | CO[C@@H]1C(=O)[C@@H](F)C[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C1CC1 |
| InChI | InChI=1S/C16H21FO4/c1-15(11(21-15)6-5-9-3-4-9)14-13(19-2)12(18)10(17)7-16(14)8-20-16/h5,10-11,13-14H,3-4,6-8H2,1-2H3/t10-,11+,13+,14+,15-,16-/m0/s1 |
| InChIKey | UCKDHVGSJAACIA-JEZYXASSSA-N |
| XLogP | 1.97 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|