C12H20O3 — CID 160829266
(3aR,6S,6aS)-3a,4-diethyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-6-ol (PubChem CID 160829266) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3aR,6S,6aS)-3a,4-diethyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-6-ol.
| Compound Name | (3aR,6S,6aS)-3a,4-diethyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 160829266 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3aR,6S,6aS)-3a,4-diethyl-2,2-dimethyl-6,6a-dihydrocyclopenta[d][1,3]dioxol-6-ol |
| SMILES | CCC1=C[C@H](O)[C@@H]2OC(C)(C)O[C@]12CC |
| InChI | InChI=1S/C12H20O3/c1-5-8-7-9(13)10-12(8,6-2)15-11(3,4)14-10/h7,9-10,13H,5-6H2,1-4H3/t9-,10-,12+/m0/s1 |
| InChIKey | SGOVCDKUXRIXOC-JBLDHEPKSA-N |
| XLogP | 2.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|