About (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride
(5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride (PubChem CID 160830505) has the molecular formula C18H16BF5NP
and a molecular weight of 383.11 g/mol. Its IUPAC name is (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride.
Molecular Properties
| Compound Name | (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride |
| PubChem CID | 160830505 |
| Molecular Formula | C18H16BF5NP |
| Molecular Weight | 383.11 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride |
| SMILES | C[n+]1cc(F)ccc1P(c1ccccc1)c1ccccc1.FB(F)F.[F-] |
| InChI | InChI=1S/C18H16FNP.BF3.FH/c1-20-14-15(19)12-13-18(20)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;2-1(3)4;/h2-14H,1H3;;1H/q+1;;/p-1 |
| InChIKey | BNFVEHKHYKBBMI-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.11 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride?
The IUPAC name of (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride (CID 160830505) is (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride.
What is the SMILES notation for (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride?
The canonical SMILES for (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride is C[n+]1cc(F)ccc1P(c1ccccc1)c1ccccc1.FB(F)F.[F-].
What is the InChIKey of (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride?
The InChIKey is BNFVEHKHYKBBMI-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H16FNP.BF3.FH/c1-20-14-15(19)12-13-18(20)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;2-1(3)4;/h2-14H,1H3;;1H/q+1;;/p-1.
What are the key properties of (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride?
(5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride has a molecular weight of 383.11 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-1-methylpyridin-1-ium-2-yl)-diphenylphosphane;trifluoroborane;fluoride is sourced from PubChem (CID 160830505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).