C34H43NO10S3Si — CID 160830788
2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxyethyl 2-acetyloxyacetate (PubChem CID 160830788) has the molecular formula C34H43NO10S3Si and a molecular weight of 750.00 g/mol. Its IUPAC name is 2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxyethyl 2-acetyloxyacetate.
| Compound Name | 2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxyethyl 2-acetyloxyacetate |
|---|---|
| PubChem CID | 160830788 |
| Molecular Formula | C34H43NO10S3Si |
| Molecular Weight | 750.00 g/mol |
| Exact Mass | 749.18 |
| IUPAC Name | 2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxyethyl 2-acetyloxyacetate |
| SMILES | CCN(C(=O)OCCOC(=O)COC(C)=O)[C@H]1C[C@H](C)S(=O)(=O)c2sc(S(=O)(=O)C[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc21 |
| InChI | InChI=1S/C34H43NO10S3Si/c1-7-35(33(38)44-19-18-43-30(37)22-45-25(3)36)29-20-24(2)48(41,42)32-28(29)21-31(46-32)47(39,40)23-49(34(4,5)6,26-14-10-8-11-15-26)27-16-12-9-13-17-27/h8-17,21,24,29H,7,18-20,22-23H2,1-6H3/t24-,29-/m0/s1 |
| InChIKey | SNCNHVSFZDTUOK-OUTSHDOLSA-N |
| XLogP | 4.30 |
| TPSA | 150.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.00 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|