C37H49NO10S3Si — CID 159195542
4-O-[2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxypropyl] 1-O-ethyl butanedioate (PubChem CID 159195542) has the molecular formula C37H49NO10S3Si and a molecular weight of 792.08 g/mol. Its IUPAC name is 4-O-[2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxypropyl] 1-O-ethyl butanedioate.
| Compound Name | 4-O-[2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxypropyl] 1-O-ethyl butanedioate |
|---|---|
| PubChem CID | 159195542 |
| Molecular Formula | C37H49NO10S3Si |
| Molecular Weight | 792.08 g/mol |
| Exact Mass | 791.23 |
| IUPAC Name | 4-O-[2-[[(4S,6S)-2-[[tert-butyl(diphenyl)silyl]methylsulfonyl]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-ethylcarbamoyl]oxypropyl] 1-O-ethyl butanedioate |
| SMILES | CCOC(=O)CCC(=O)OCC(C)OC(=O)N(CC)[C@H]1C[C@H](C)S(=O)(=O)c2sc(S(=O)(=O)C[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc21 |
| InChI | InChI=1S/C37H49NO10S3Si/c1-8-38(36(41)48-26(3)24-47-33(40)21-20-32(39)46-9-2)31-22-27(4)51(44,45)35-30(31)23-34(49-35)50(42,43)25-52(37(5,6)7,28-16-12-10-13-17-28)29-18-14-11-15-19-29/h10-19,23,26-27,31H,8-9,20-22,24-25H2,1-7H3/t26?,27-,31-/m0/s1 |
| InChIKey | KOPODTAWVIQLGZ-XTEJFLLXSA-N |
| XLogP | 5.46 |
| TPSA | 150.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.08 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|