C36H48N2O6 — CID 160833864
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclohexylpenta-2,4-dienamide;5-(1,3-benzodioxol-5-yl)-N-cyclohexylpentanamide;molecular hydrogen (PubChem CID 160833864) has the molecular formula C36H48N2O6 and a molecular weight of 604.79 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclohexylpenta-2,4-dienamide;5-(1,3-benzodioxol-5-yl)-N-cyclohexylpentanamide;molecular hydrogen.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclohexylpenta-2,4-dienamide;5-(1,3-benzodioxol-5-yl)-N-cyclohexylpentanamide;molecular hydrogen |
|---|---|
| PubChem CID | 160833864 |
| Molecular Formula | C36H48N2O6 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclohexylpenta-2,4-dienamide;5-(1,3-benzodioxol-5-yl)-N-cyclohexylpentanamide;molecular hydrogen |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)NC1CCCCC1.O=C(CCCCc1ccc2c(c1)OCO2)NC1CCCCC1.[H][H] |
| InChI | InChI=1S/C18H25NO3.C18H21NO3.H2/c2*20-18(19-15-7-2-1-3-8-15)9-5-4-6-14-10-11-16-17(12-14)22-13-21-16;/h10-12,15H,1-9,13H2,(H,19,20);4-6,9-12,15H,1-3,7-8,13H2,(H,19,20);1H/b;6-4+,9-5+; |
| InChIKey | SHDRUKGVYFNUOW-HZCURYQCSA-N |
| XLogP | 7.26 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|