C29H36N2 — CID 160837004
4-tert-butyl-2,5,6,7,8,9,10,11,12-nonamethylphenanthro[9,10-d]pyrimidine (PubChem CID 160837004) has the molecular formula C29H36N2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 4-tert-butyl-2,5,6,7,8,9,10,11,12-nonamethylphenanthro[9,10-d]pyrimidine.
| Compound Name | 4-tert-butyl-2,5,6,7,8,9,10,11,12-nonamethylphenanthro[9,10-d]pyrimidine |
|---|---|
| PubChem CID | 160837004 |
| Molecular Formula | C29H36N2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | 4-tert-butyl-2,5,6,7,8,9,10,11,12-nonamethylphenanthro[9,10-d]pyrimidine |
| SMILES | Cc1nc(C(C)(C)C)c2c(n1)c1c(C)c(C)c(C)c(C)c1c1c(C)c(C)c(C)c(C)c21 |
| InChI | InChI=1S/C29H36N2/c1-13-14(2)19(7)24-22(17(13)5)23-18(6)15(3)16(4)20(8)25(23)27-26(24)28(29(10,11)12)31-21(9)30-27/h1-12H3 |
| InChIKey | HFWWIUWGDXJXKL-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|