C23H29ClN3O3S+ — CID 160838637
[4-[[(4-chlorophenyl)methyl-[(1-ethoxycarbonylpyrrolidin-3-yl)methyl]amino]methyl]phenyl]sulfanyl-methyl-oxoazanium (PubChem CID 160838637) has the molecular formula C23H29ClN3O3S+ and a molecular weight of 463.02 g/mol. Its IUPAC name is [4-[[(4-chlorophenyl)methyl-[(1-ethoxycarbonylpyrrolidin-3-yl)methyl]amino]methyl]phenyl]sulfanyl-methyl-oxoazanium.
| Compound Name | [4-[[(4-chlorophenyl)methyl-[(1-ethoxycarbonylpyrrolidin-3-yl)methyl]amino]methyl]phenyl]sulfanyl-methyl-oxoazanium |
|---|---|
| PubChem CID | 160838637 |
| Molecular Formula | C23H29ClN3O3S+ |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [4-[[(4-chlorophenyl)methyl-[(1-ethoxycarbonylpyrrolidin-3-yl)methyl]amino]methyl]phenyl]sulfanyl-methyl-oxoazanium |
| SMILES | CCOC(=O)N1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc(S[N+](C)=O)cc2)C1 |
| InChI | InChI=1S/C23H29ClN3O3S/c1-3-30-23(28)27-13-12-20(17-27)16-26(14-18-4-8-21(24)9-5-18)15-19-6-10-22(11-7-19)31-25(2)29/h4-11,20H,3,12-17H2,1-2H3/q+1 |
| InChIKey | JNOQJNKYSAGXPK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|