C23H26N4O3 — CID 160840794
methyl 5-[4-[(7-ethyl-6-oxo-5H-quinolin-3-yl)methyl]piperazin-1-yl]pyridine-2-carboxylate (PubChem CID 160840794) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is methyl 5-[4-[(7-ethyl-6-oxo-5H-quinolin-3-yl)methyl]piperazin-1-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[4-[(7-ethyl-6-oxo-5H-quinolin-3-yl)methyl]piperazin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 160840794 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | methyl 5-[4-[(7-ethyl-6-oxo-5H-quinolin-3-yl)methyl]piperazin-1-yl]pyridine-2-carboxylate |
| SMILES | CCC1=Cc2ncc(CN3CCN(c4ccc(C(=O)OC)nc4)CC3)cc2CC1=O |
| InChI | InChI=1S/C23H26N4O3/c1-3-17-11-21-18(12-22(17)28)10-16(13-24-21)15-26-6-8-27(9-7-26)19-4-5-20(25-14-19)23(29)30-2/h4-5,10-11,13-14H,3,6-9,12,15H2,1-2H3 |
| InChIKey | WHSSEESNFITTRO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |