C30H40N6O7 — CID 160848374
(2S)-8-[[3-[4-[[4-[(2-aminoacetyl)amino]phenyl]diazenyl]phenyl]-2-oxopropyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoic acid (PubChem CID 160848374) has the molecular formula C30H40N6O7 and a molecular weight of 596.69 g/mol. Its IUPAC name is (2S)-8-[[3-[4-[[4-[(2-aminoacetyl)amino]phenyl]diazenyl]phenyl]-2-oxopropyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoic acid.
| Compound Name | (2S)-8-[[3-[4-[[4-[(2-aminoacetyl)amino]phenyl]diazenyl]phenyl]-2-oxopropyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 160848374 |
| Molecular Formula | C30H40N6O7 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | (2S)-8-[[3-[4-[[4-[(2-aminoacetyl)amino]phenyl]diazenyl]phenyl]-2-oxopropyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCCC(=O)NCC(=O)Cc1ccc(/N=N/c2ccc(NC(=O)CN)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H40N6O7/c1-30(2,3)43-29(42)34-25(28(40)41)7-5-4-6-8-26(38)32-19-24(37)17-20-9-11-22(12-10-20)35-36-23-15-13-21(14-16-23)33-27(39)18-31/h9-16,25H,4-8,17-19,31H2,1-3H3,(H,32,38)(H,33,39)(H,34,42)(H,40,41)/b36-35+/t25-/m0/s1 |
| InChIKey | OZUVZXGWCWVNKG-STFNVURLSA-N |
| XLogP | 4.16 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|