C25H20O7S — CID 160857482
2-hydroxybenzoic acid;4-hydroxy-2,3-diphenylbenzenesulfonic acid (PubChem CID 160857482) has the molecular formula C25H20O7S and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;4-hydroxy-2,3-diphenylbenzenesulfonic acid.
| Compound Name | 2-hydroxybenzoic acid;4-hydroxy-2,3-diphenylbenzenesulfonic acid |
|---|---|
| PubChem CID | 160857482 |
| Molecular Formula | C25H20O7S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 2-hydroxybenzoic acid;4-hydroxy-2,3-diphenylbenzenesulfonic acid |
| SMILES | O=C(O)c1ccccc1O.O=S(=O)(O)c1ccc(O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H14O4S.C7H6O3/c19-15-11-12-16(23(20,21)22)18(14-9-5-2-6-10-14)17(15)13-7-3-1-4-8-13;8-6-4-2-1-3-5(6)7(9)10/h1-12,19H,(H,20,21,22);1-4,8H,(H,9,10) |
| InChIKey | SKAXTMVUKSNXKO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|