About 5-cyclohexylpentanoic acid;ethenyl acetate
5-cyclohexylpentanoic acid;ethenyl acetate (PubChem CID 160870806) has the molecular formula C15H26O4
and a molecular weight of 270.37 g/mol. Its IUPAC name is 5-cyclohexylpentanoic acid;ethenyl acetate.
Molecular Properties
| Compound Name | 5-cyclohexylpentanoic acid;ethenyl acetate |
| PubChem CID | 160870806 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 5-cyclohexylpentanoic acid;ethenyl acetate |
| SMILES | C=COC(C)=O.O=C(O)CCCCC1CCCCC1 |
| InChI | InChI=1S/C11H20O2.C4H6O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;1-3-6-4(2)5/h10H,1-9H2,(H,12,13);3H,1H2,2H3 |
| InChIKey | SLSPIAUUKAYJFL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexylpentanoic acid;ethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexylpentanoic acid;ethenyl acetate?
The IUPAC name of 5-cyclohexylpentanoic acid;ethenyl acetate (CID 160870806) is 5-cyclohexylpentanoic acid;ethenyl acetate.
What is the SMILES notation for 5-cyclohexylpentanoic acid;ethenyl acetate?
The canonical SMILES for 5-cyclohexylpentanoic acid;ethenyl acetate is C=COC(C)=O.O=C(O)CCCCC1CCCCC1.
What is the InChIKey of 5-cyclohexylpentanoic acid;ethenyl acetate?
The InChIKey is SLSPIAUUKAYJFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.C4H6O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;1-3-6-4(2)5/h10H,1-9H2,(H,12,13);3H,1H2,2H3.
What are the key properties of 5-cyclohexylpentanoic acid;ethenyl acetate?
5-cyclohexylpentanoic acid;ethenyl acetate has a molecular weight of 270.37 g/mol, XLogP of 3.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexylpentanoic acid;ethenyl acetate is sourced from PubChem (CID 160870806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).