C26H39ClN4O5S — CID 160871123
4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-N-hydroxy-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 160871123) has the molecular formula C26H39ClN4O5S and a molecular weight of 555.14 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-N-hydroxy-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-N-hydroxy-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 160871123 |
| Molecular Formula | C26H39ClN4O5S |
| Molecular Weight | 555.14 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperidin-1-yl]sulfonyl-N-hydroxy-1-(1H-pyrrol-2-ylmethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCOc1ccc(C2CCN(S(=O)(=O)C3(C(=O)NO)CCN(Cc4ccc[nH]4)CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C26H38N4O5S.ClH/c1-2-3-19-35-24-8-6-21(7-9-24)22-10-15-30(16-11-22)36(33,34)26(25(31)28-32)12-17-29(18-13-26)20-23-5-4-14-27-23;/h4-9,14,22,27,32H,2-3,10-13,15-20H2,1H3,(H,28,31);1H |
| InChIKey | LVJCEZMJPCVCLG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|