C19H28N4O7S — CID 11753814
N-hydroxy-4-[4-[5-[(2Z)-2-hydroxyiminopropoxy]-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 11753814) has the molecular formula C19H28N4O7S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-[(2Z)-2-hydroxyiminopropoxy]-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-[(2Z)-2-hydroxyiminopropoxy]-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 11753814 |
| Molecular Formula | C19H28N4O7S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-hydroxy-4-[4-[5-[(2Z)-2-hydroxyiminopropoxy]-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | C/C(COc1ccc(C2CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)nc1)=N/O |
| InChI | InChI=1S/C19H28N4O7S/c1-14(21-25)13-30-16-2-3-17(20-12-16)15-4-8-23(9-5-15)31(27,28)19(18(24)22-26)6-10-29-11-7-19/h2-3,12,15,25-26H,4-11,13H2,1H3,(H,22,24)/b21-14- |
| InChIKey | RYBDBKWJWUSGSE-STZFKDTASA-N |
| XLogP | 0.87 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|