About 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile
3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile (PubChem CID 160880449) has the molecular formula C16H10N6
and a molecular weight of 286.30 g/mol. Its IUPAC name is 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile |
| PubChem CID | 160880449 |
| Molecular Formula | C16H10N6 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(N)cc1C#N.N#Cc1cccc(N)c1C#N |
| InChI | InChI=1S/2C8H5N3/c9-4-6-1-2-8(11)3-7(6)5-10;9-4-6-2-1-3-8(11)7(6)5-10/h2*1-3H,11H2 |
| InChIKey | SMYORXHLHZKLGX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile?
The IUPAC name of 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile (CID 160880449) is 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile?
The canonical SMILES for 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile is N#Cc1ccc(N)cc1C#N.N#Cc1cccc(N)c1C#N.
What is the InChIKey of 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile?
The InChIKey is SMYORXHLHZKLGX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H5N3/c9-4-6-1-2-8(11)3-7(6)5-10;9-4-6-2-1-3-8(11)7(6)5-10/h2*1-3H,11H2.
What are the key properties of 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile?
3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile has a molecular weight of 286.30 g/mol, XLogP of 2.02, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzene-1,2-dicarbonitrile;4-aminobenzene-1,2-dicarbonitrile is sourced from PubChem (CID 160880449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).