C24H34N2O8 — CID 160880607
2-[(1R,5S,6S)-3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 160880607) has the molecular formula C24H34N2O8 and a molecular weight of 478.54 g/mol. Its IUPAC name is 2-[(1R,5S,6S)-3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1R,5S,6S)-3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 160880607 |
| Molecular Formula | C24H34N2O8 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-[(1R,5S,6S)-3-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@@]2(CC(=O)O)C[N+](=O)[O-].CCC1=C[C@@H]2[C@H](C1)C[C@@]2(CC(=O)O)C[N+](=O)[O-] |
| InChI | InChI=1S/2C12H17NO4/c2*1-2-8-3-9-5-12(6-11(14)15,7-13(16)17)10(9)4-8/h2*4,9-10H,2-3,5-7H2,1H3,(H,14,15)/t2*9-,10-,12-/m11/s1 |
| InChIKey | SMZCQWAQYJIZPA-QWIAZOMXSA-N |
| XLogP | 4.20 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|