C48H39O4P — CID 160884923
[5-(3,4-dimethoxyphenyl)-1-[5-(3,4-dimethoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]-diphenylphosphane (PubChem CID 160884923) has the molecular formula C48H39O4P and a molecular weight of 710.81 g/mol. Its IUPAC name is [5-(3,4-dimethoxyphenyl)-1-[5-(3,4-dimethoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]-diphenylphosphane.
| Compound Name | [5-(3,4-dimethoxyphenyl)-1-[5-(3,4-dimethoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 160884923 |
| Molecular Formula | C48H39O4P |
| Molecular Weight | 710.81 g/mol |
| Exact Mass | 710.26 |
| IUPAC Name | [5-(3,4-dimethoxyphenyl)-1-[5-(3,4-dimethoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]-diphenylphosphane |
| SMILES | COc1ccc(-c2cccc3c(-c4c(P(c5ccccc5)c5ccccc5)ccc5c(-c6ccc(OC)c(OC)c6)cccc45)cccc23)cc1OC |
| InChI | InChI=1S/C48H39O4P/c1-49-43-27-24-32(30-45(43)51-3)36-18-11-21-39-38(36)20-13-23-41(39)48-42-22-12-19-37(33-25-28-44(50-2)46(31-33)52-4)40(42)26-29-47(48)53(34-14-7-5-8-15-34)35-16-9-6-10-17-35/h5-31H,1-4H3 |
| InChIKey | SNMZHZWUVMPUSJ-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.81 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|