About 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole
7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole (PubChem CID 160889689) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole.
Molecular Properties
| Compound Name | 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole |
| PubChem CID | 160889689 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole |
| SMILES | CCC1CC2(CC2)OCO1.O=[N+]([O-])c1ccn[nH]1 |
| InChI | InChI=1S/C8H14O2.C3H3N3O2/c1-2-7-5-8(3-4-8)10-6-9-7;7-6(8)3-1-2-4-5-3/h7H,2-6H2,1H3;1-2H,(H,4,5) |
| InChIKey | SOCHOYZRBLFMOX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole?
The IUPAC name of 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole (CID 160889689) is 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole.
What is the SMILES notation for 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole?
The canonical SMILES for 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole is CCC1CC2(CC2)OCO1.O=[N+]([O-])c1ccn[nH]1.
What is the InChIKey of 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole?
The InChIKey is SOCHOYZRBLFMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C3H3N3O2/c1-2-7-5-8(3-4-8)10-6-9-7;7-6(8)3-1-2-4-5-3/h7H,2-6H2,1H3;1-2H,(H,4,5).
What are the key properties of 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole?
7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole has a molecular weight of 255.27 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4,6-dioxaspiro[2.5]octane;5-nitro-1H-pyrazole is sourced from PubChem (CID 160889689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).