C17H19F2I — CID 160890095
1,3-difluorobenzene;1-iodo-4-(2-methylbutan-2-yl)benzene (PubChem CID 160890095) has the molecular formula C17H19F2I and a molecular weight of 388.24 g/mol. Its IUPAC name is 1,3-difluorobenzene;1-iodo-4-(2-methylbutan-2-yl)benzene.
| Compound Name | 1,3-difluorobenzene;1-iodo-4-(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 160890095 |
| Molecular Formula | C17H19F2I |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 1,3-difluorobenzene;1-iodo-4-(2-methylbutan-2-yl)benzene |
| SMILES | CCC(C)(C)c1ccc(I)cc1.Fc1cccc(F)c1 |
| InChI | InChI=1S/C11H15I.C6H4F2/c1-4-11(2,3)9-5-7-10(12)8-6-9;7-5-2-1-3-6(8)4-5/h5-8H,4H2,1-3H3;1-4H |
| InChIKey | SODORYCQJIUOMF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|