C19H17ClF3NO3 — CID 160892035
2-amino-2-[5-chloro-2-(4,4,4-trifluorobutyl)phenyl]-3-oxo-3-phenylpropanoic acid (PubChem CID 160892035) has the molecular formula C19H17ClF3NO3 and a molecular weight of 399.80 g/mol. Its IUPAC name is 2-amino-2-[5-chloro-2-(4,4,4-trifluorobutyl)phenyl]-3-oxo-3-phenylpropanoic acid.
| Compound Name | 2-amino-2-[5-chloro-2-(4,4,4-trifluorobutyl)phenyl]-3-oxo-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 160892035 |
| Molecular Formula | C19H17ClF3NO3 |
| Molecular Weight | 399.80 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-amino-2-[5-chloro-2-(4,4,4-trifluorobutyl)phenyl]-3-oxo-3-phenylpropanoic acid |
| SMILES | NC(C(=O)O)(C(=O)c1ccccc1)c1cc(Cl)ccc1CCCC(F)(F)F |
| InChI | InChI=1S/C19H17ClF3NO3/c20-14-9-8-12(7-4-10-18(21,22)23)15(11-14)19(24,17(26)27)16(25)13-5-2-1-3-6-13/h1-3,5-6,8-9,11H,4,7,10,24H2,(H,26,27) |
| InChIKey | SOJZZTUZJZPOBS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|